About spiro[3.3]heptane-2,6-diamine;dihydrochloride
spiro[3.3]heptane-2,6-diamine;dihydrochloride (PubChem CID 43810934) has the molecular formula C7H16Cl2N2
and a molecular weight of 199.12 g/mol. Its IUPAC name is spiro[3.3]heptane-2,6-diamine;dihydrochloride.
Molecular Properties
| Compound Name | spiro[3.3]heptane-2,6-diamine;dihydrochloride |
| PubChem CID | 43810934 |
| Molecular Formula | C7H16Cl2N2 |
| Molecular Weight | 199.12 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | spiro[3.3]heptane-2,6-diamine;dihydrochloride |
| SMILES | Cl.Cl.NC1CC2(C1)CC(N)C2 |
| InChI | InChI=1S/C7H14N2.2ClH/c8-5-1-7(2-5)3-6(9)4-7;;/h5-6H,1-4,8-9H2;2*1H |
| InChIKey | LEEAKLAUQJIGMJ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.12 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3.3]heptane-2,6-diamine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3.3]heptane-2,6-diamine;dihydrochloride?
The IUPAC name of spiro[3.3]heptane-2,6-diamine;dihydrochloride (CID 43810934) is spiro[3.3]heptane-2,6-diamine;dihydrochloride.
What is the SMILES notation for spiro[3.3]heptane-2,6-diamine;dihydrochloride?
The canonical SMILES for spiro[3.3]heptane-2,6-diamine;dihydrochloride is Cl.Cl.NC1CC2(C1)CC(N)C2.
What is the InChIKey of spiro[3.3]heptane-2,6-diamine;dihydrochloride?
The InChIKey is LEEAKLAUQJIGMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2.2ClH/c8-5-1-7(2-5)3-6(9)4-7;;/h5-6H,1-4,8-9H2;2*1H.
What are the key properties of spiro[3.3]heptane-2,6-diamine;dihydrochloride?
spiro[3.3]heptane-2,6-diamine;dihydrochloride has a molecular weight of 199.12 g/mol, XLogP of 1.06, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3.3]heptane-2,6-diamine;dihydrochloride is sourced from PubChem (CID 43810934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).