C16H6F5NO2S — CID 43811045
(2,3,4,5,6-pentafluorophenyl) 5-pyridin-3-ylthiophene-2-carboxylate (PubChem CID 43811045) has the molecular formula C16H6F5NO2S and a molecular weight of 371.29 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 5-pyridin-3-ylthiophene-2-carboxylate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 5-pyridin-3-ylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 43811045 |
| Molecular Formula | C16H6F5NO2S |
| Molecular Weight | 371.29 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 5-pyridin-3-ylthiophene-2-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(-c2cccnc2)s1 |
| InChI | InChI=1S/C16H6F5NO2S/c17-10-11(18)13(20)15(14(21)12(10)19)24-16(23)9-4-3-8(25-9)7-2-1-5-22-6-7/h1-6H |
| InChIKey | IDMGFJPLJHXOJV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.29 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|