C17H25BFNO3 — CID 43811063
4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine (PubChem CID 43811063) has the molecular formula C17H25BFNO3 and a molecular weight of 321.20 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine.
| Compound Name | 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
|---|---|
| PubChem CID | 43811063 |
| Molecular Formula | C17H25BFNO3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 4-[[2-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]morpholine |
| SMILES | CC1(C)OB(c2ccc(CN3CCOCC3)c(F)c2)OC1(C)C |
| InChI | InChI=1S/C17H25BFNO3/c1-16(2)17(3,4)23-18(22-16)14-6-5-13(15(19)11-14)12-20-7-9-21-10-8-20/h5-6,11H,7-10,12H2,1-4H3 |
| InChIKey | QINFDPZSZHPUSC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|