About 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile
4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile (PubChem CID 43811105) has the molecular formula C10H10N2O
and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile.
Molecular Properties
| Compound Name | 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile |
| PubChem CID | 43811105 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile |
| SMILES | CN1CCOc2cc(C#N)ccc21 |
| InChI | InChI=1S/C10H10N2O/c1-12-4-5-13-10-6-8(7-11)2-3-9(10)12/h2-3,6H,4-5H2,1H3 |
| InChIKey | MBNHXEGWTJIPMG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile?
The IUPAC name of 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile (CID 43811105) is 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile.
What is the SMILES notation for 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile?
The canonical SMILES for 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile is CN1CCOc2cc(C#N)ccc21.
What is the InChIKey of 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile?
The InChIKey is MBNHXEGWTJIPMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O/c1-12-4-5-13-10-6-8(7-11)2-3-9(10)12/h2-3,6H,4-5H2,1H3.
What are the key properties of 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile?
4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile has a molecular weight of 174.20 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-2,3-dihydro-1,4-benzoxazine-7-carbonitrile is sourced from PubChem (CID 43811105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).