C15H9FN4O2S2 — CID 43811775
2-[[12-(4-fluorophenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]sulfanyl]acetic acid (PubChem CID 43811775) has the molecular formula C15H9FN4O2S2 and a molecular weight of 360.40 g/mol. Its IUPAC name is 2-[[12-(4-fluorophenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]sulfanyl]acetic acid.
| Compound Name | 2-[[12-(4-fluorophenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]sulfanyl]acetic acid |
|---|---|
| PubChem CID | 43811775 |
| Molecular Formula | C15H9FN4O2S2 |
| Molecular Weight | 360.40 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | 2-[[12-(4-fluorophenyl)-10-thia-3,4,6,8-tetrazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,7,11-pentaen-5-yl]sulfanyl]acetic acid |
| SMILES | O=C(O)CSc1nnc2c3c(-c4ccc(F)cc4)csc3ncn12 |
| InChI | InChI=1S/C15H9FN4O2S2/c16-9-3-1-8(2-4-9)10-5-23-14-12(10)13-18-19-15(20(13)7-17-14)24-6-11(21)22/h1-5,7H,6H2,(H,21,22) |
| InChIKey | DFBYWSCWUSHIBV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 80.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.40 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |