About 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea
1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea (PubChem CID 43811954) has the molecular formula C23H23N5O2
and a molecular weight of 401.47 g/mol. Its IUPAC name is 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea.
Molecular Properties
| Compound Name | 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea |
| PubChem CID | 43811954 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea |
| SMILES | COc1ccc(Cn2c(C)nc3cc(NC(=O)Nc4ccccc4)c(C)nc32)cc1 |
| InChI | InChI=1S/C23H23N5O2/c1-15-20(27-23(29)26-18-7-5-4-6-8-18)13-21-22(24-15)28(16(2)25-21)14-17-9-11-19(30-3)12-10-17/h4-13H,14H2,1-3H3,(H2,26,27,29) |
| InChIKey | JDXLXDQKNWKCDO-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea?
The IUPAC name of 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea (CID 43811954) is 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea.
What is the SMILES notation for 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea?
The canonical SMILES for 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea is COc1ccc(Cn2c(C)nc3cc(NC(=O)Nc4ccccc4)c(C)nc32)cc1.
What is the InChIKey of 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea?
The InChIKey is JDXLXDQKNWKCDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23N5O2/c1-15-20(27-23(29)26-18-7-5-4-6-8-18)13-21-22(24-15)28(16(2)25-21)14-17-9-11-19(30-3)12-10-17/h4-13H,14H2,1-3H3,(H2,26,27,29).
What are the key properties of 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea?
1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea has a molecular weight of 401.47 g/mol, XLogP of 4.75, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-[(4-methoxyphenyl)methyl]-2,5-dimethylimidazo[4,5-b]pyridin-6-yl]-3-phenylurea is sourced from PubChem (CID 43811954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).