C20H22N8OS3 — CID 43811993
2-[[4-ethyl-5-[[(4-phenyl-1,3-thiazol-2-yl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 43811993) has the molecular formula C20H22N8OS3 and a molecular weight of 486.65 g/mol. Its IUPAC name is 2-[[4-ethyl-5-[[(4-phenyl-1,3-thiazol-2-yl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[[4-ethyl-5-[[(4-phenyl-1,3-thiazol-2-yl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 43811993 |
| Molecular Formula | C20H22N8OS3 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | 2-[[4-ethyl-5-[[(4-phenyl-1,3-thiazol-2-yl)amino]methyl]-1,2,4-triazol-3-yl]sulfanyl]-N-(5-ethyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCc1nnc(NC(=O)CSc2nnc(CNc3nc(-c4ccccc4)cs3)n2CC)s1 |
| InChI | InChI=1S/C20H22N8OS3/c1-3-17-25-26-19(32-17)23-16(29)12-31-20-27-24-15(28(20)4-2)10-21-18-22-14(11-30-18)13-8-6-5-7-9-13/h5-9,11H,3-4,10,12H2,1-2H3,(H,21,22)(H,23,26,29) |
| InChIKey | WNIUXYNLMZMLIA-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 110.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |