About 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea
1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 43815138) has the molecular formula C18H23N5OS
and a molecular weight of 357.48 g/mol. Its IUPAC name is 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea.
Molecular Properties
| Compound Name | 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea |
| PubChem CID | 43815138 |
| Molecular Formula | C18H23N5OS |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NCCNc1nc2c(C)cc(C)cc2cc1C#N |
| InChI | InChI=1S/C18H23N5OS/c1-12-8-13(2)16-14(9-12)10-15(11-19)17(23-16)20-4-5-21-18(25)22-6-7-24-3/h8-10H,4-7H2,1-3H3,(H,20,23)(H2,21,22,25) |
| InChIKey | RSDHBPYIYPWJCE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea?
The IUPAC name of 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea (CID 43815138) is 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea.
What is the SMILES notation for 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea?
The canonical SMILES for 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea is COCCNC(=S)NCCNc1nc2c(C)cc(C)cc2cc1C#N.
What is the InChIKey of 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea?
The InChIKey is RSDHBPYIYPWJCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H23N5OS/c1-12-8-13(2)16-14(9-12)10-15(11-19)17(23-16)20-4-5-21-18(25)22-6-7-24-3/h8-10H,4-7H2,1-3H3,(H,20,23)(H2,21,22,25).
What are the key properties of 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea?
1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea has a molecular weight of 357.48 g/mol, XLogP of 2.25, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-[(3-cyano-6,8-dimethylquinolin-2-yl)amino]ethyl]-3-(2-methoxyethyl)thiourea is sourced from PubChem (CID 43815138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).