About N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide
N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide (PubChem CID 43815411) has the molecular formula C21H20N4O
and a molecular weight of 344.42 g/mol. Its IUPAC name is N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide.
Molecular Properties
| Compound Name | N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide |
| PubChem CID | 43815411 |
| Molecular Formula | C21H20N4O |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide |
| SMILES | Cc1cc(C)c2cc(C#N)c(NCCNC(=O)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C21H20N4O/c1-14-10-15(2)18-12-17(13-22)20(25-19(18)11-14)23-8-9-24-21(26)16-6-4-3-5-7-16/h3-7,10-12H,8-9H2,1-2H3,(H,23,25)(H,24,26) |
| InChIKey | KSGJIDGCGBRSGU-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide?
The IUPAC name of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide (CID 43815411) is N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide.
What is the SMILES notation for N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide?
The canonical SMILES for N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide is Cc1cc(C)c2cc(C#N)c(NCCNC(=O)c3ccccc3)nc2c1.
What is the InChIKey of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide?
The InChIKey is KSGJIDGCGBRSGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N4O/c1-14-10-15(2)18-12-17(13-22)20(25-19(18)11-14)23-8-9-24-21(26)16-6-4-3-5-7-16/h3-7,10-12H,8-9H2,1-2H3,(H,23,25)(H,24,26).
What are the key properties of N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide?
N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide has a molecular weight of 344.42 g/mol, XLogP of 3.57, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[(3-cyano-5,7-dimethylquinolin-2-yl)amino]ethyl]benzamide is sourced from PubChem (CID 43815411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).