C10H7F3N4OS2 — CID 43815706
2-(thiatriazol-5-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 43815706) has the molecular formula C10H7F3N4OS2 and a molecular weight of 320.32 g/mol. Its IUPAC name is 2-(thiatriazol-5-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(thiatriazol-5-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 43815706 |
| Molecular Formula | C10H7F3N4OS2 |
| Molecular Weight | 320.32 g/mol |
| Exact Mass | 320.00 |
| IUPAC Name | 2-(thiatriazol-5-ylsulfanyl)-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nnns1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C10H7F3N4OS2/c11-10(12,13)6-3-1-2-4-7(6)14-8(18)5-19-9-15-16-17-20-9/h1-4H,5H2,(H,14,18) |
| InChIKey | TXTQYHDTQGDDIM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |