C21H21FN2O4S2 — CID 43816068
4-N-benzyl-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-disulfonamide (PubChem CID 43816068) has the molecular formula C21H21FN2O4S2 and a molecular weight of 448.54 g/mol. Its IUPAC name is 4-N-benzyl-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-benzyl-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 43816068 |
| Molecular Formula | C21H21FN2O4S2 |
| Molecular Weight | 448.54 g/mol |
| Exact Mass | 448.09 |
| IUPAC Name | 4-N-benzyl-1-N-[2-(2-fluorophenyl)ethyl]benzene-1,4-disulfonamide |
| SMILES | O=S(=O)(NCCc1ccccc1F)c1ccc(S(=O)(=O)NCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H21FN2O4S2/c22-21-9-5-4-8-18(21)14-15-23-29(25,26)19-10-12-20(13-11-19)30(27,28)24-16-17-6-2-1-3-7-17/h1-13,23-24H,14-16H2 |
| InChIKey | MYRSFPKNQFMNND-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.54 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |