C15H16N4O — CID 43816842
2-(1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaen-16-ylamino)ethanol (PubChem CID 43816842) has the molecular formula C15H16N4O and a molecular weight of 268.32 g/mol. Its IUPAC name is 2-(1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaen-16-ylamino)ethanol.
| Compound Name | 2-(1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaen-16-ylamino)ethanol |
|---|---|
| PubChem CID | 43816842 |
| Molecular Formula | C15H16N4O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 2-(1,8,10-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-2,4,6,8,10,15-hexaen-16-ylamino)ethanol |
| SMILES | OCCNc1c2c(nc3nc4ccccc4n13)CCC2 |
| InChI | InChI=1S/C15H16N4O/c20-9-8-16-14-10-4-3-6-11(10)17-15-18-12-5-1-2-7-13(12)19(14)15/h1-2,5,7,16,20H,3-4,6,8-9H2 |
| InChIKey | ZUHNLISIFXNBOR-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |