About [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol
[1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol (PubChem CID 43818111) has the molecular formula C17H25NO3
and a molecular weight of 291.39 g/mol. Its IUPAC name is [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol.
Molecular Properties
| Compound Name | [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol |
| PubChem CID | 43818111 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol |
| SMILES | C=CCc1cc(CN2CCC(CO)C2)cc(OC)c1OC |
| InChI | InChI=1S/C17H25NO3/c1-4-5-15-8-14(9-16(20-2)17(15)21-3)11-18-7-6-13(10-18)12-19/h4,8-9,13,19H,1,5-7,10-12H2,2-3H3 |
| InChIKey | UFPAYDVJUJJRGP-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol?
The IUPAC name of [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol (CID 43818111) is [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol.
What is the SMILES notation for [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol?
The canonical SMILES for [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol is C=CCc1cc(CN2CCC(CO)C2)cc(OC)c1OC.
What is the InChIKey of [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol?
The InChIKey is UFPAYDVJUJJRGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO3/c1-4-5-15-8-14(9-16(20-2)17(15)21-3)11-18-7-6-13(10-18)12-19/h4,8-9,13,19H,1,5-7,10-12H2,2-3H3.
What are the key properties of [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol?
[1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol has a molecular weight of 291.39 g/mol, XLogP of 2.25, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(3,4-dimethoxy-5-prop-2-enylphenyl)methyl]pyrrolidin-3-yl]methanol is sourced from PubChem (CID 43818111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).