About 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol
1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol (PubChem CID 43818259) has the molecular formula C17H27N3OS
and a molecular weight of 321.49 g/mol. Its IUPAC name is 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol |
| PubChem CID | 43818259 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol |
| SMILES | CCn1nc(C)c(CN(Cc2sccc2C)CC(C)O)c1C |
| InChI | InChI=1S/C17H27N3OS/c1-6-20-15(5)16(14(4)18-20)10-19(9-13(3)21)11-17-12(2)7-8-22-17/h7-8,13,21H,6,9-11H2,1-5H3 |
| InChIKey | DPFBPJBFJISWGP-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol?
The IUPAC name of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol (CID 43818259) is 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol.
What is the SMILES notation for 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol?
The canonical SMILES for 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol is CCn1nc(C)c(CN(Cc2sccc2C)CC(C)O)c1C.
What is the InChIKey of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol?
The InChIKey is DPFBPJBFJISWGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H27N3OS/c1-6-20-15(5)16(14(4)18-20)10-19(9-13(3)21)11-17-12(2)7-8-22-17/h7-8,13,21H,6,9-11H2,1-5H3.
What are the key properties of 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol?
1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol has a molecular weight of 321.49 g/mol, XLogP of 3.27, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl-[(3-methylthiophen-2-yl)methyl]amino]propan-2-ol is sourced from PubChem (CID 43818259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).