C25H28N2O5 — CID 43818296
1-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methyl-(1,3-benzodioxol-5-ylmethyl)amino]propan-2-ol (PubChem CID 43818296) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 1-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methyl-(1,3-benzodioxol-5-ylmethyl)amino]propan-2-ol.
| Compound Name | 1-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methyl-(1,3-benzodioxol-5-ylmethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 43818296 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-[[1-(1,3-benzodioxol-5-yl)-2,5-dimethylpyrrol-3-yl]methyl-(1,3-benzodioxol-5-ylmethyl)amino]propan-2-ol |
| SMILES | Cc1cc(CN(Cc2ccc3c(c2)OCO3)CC(C)O)c(C)n1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H28N2O5/c1-16-8-20(18(3)27(16)21-5-7-23-25(10-21)32-15-30-23)13-26(11-17(2)28)12-19-4-6-22-24(9-19)31-14-29-22/h4-10,17,28H,11-15H2,1-3H3 |
| InChIKey | NDMKQFWKGWBWSS-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 65.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|