C20H23NO4 — CID 43818588
3-[[1,3-benzodioxol-5-ylmethyl(oxolan-2-ylmethyl)amino]methyl]phenol (PubChem CID 43818588) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[[1,3-benzodioxol-5-ylmethyl(oxolan-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 3-[[1,3-benzodioxol-5-ylmethyl(oxolan-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 43818588 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | 3-[[1,3-benzodioxol-5-ylmethyl(oxolan-2-ylmethyl)amino]methyl]phenol |
| SMILES | Oc1cccc(CN(Cc2ccc3c(c2)OCO3)CC2CCCO2)c1 |
| InChI | InChI=1S/C20H23NO4/c22-17-4-1-3-15(9-17)11-21(13-18-5-2-8-23-18)12-16-6-7-19-20(10-16)25-14-24-19/h1,3-4,6-7,9-10,18,22H,2,5,8,11-14H2 |
| InChIKey | IABUHIPZSRISJQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |