About N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide
N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide (PubChem CID 43822414) has the molecular formula C19H21N3O
and a molecular weight of 307.40 g/mol. Its IUPAC name is N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide.
Molecular Properties
| Compound Name | N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide |
| PubChem CID | 43822414 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide |
| SMILES | Cc1ccc(C)n1NC(=O)c1ccc(-n2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C19H21N3O/c1-13-5-6-14(2)21(13)18-11-9-17(10-12-18)19(23)20-22-15(3)7-8-16(22)4/h5-12H,1-4H3,(H,20,23) |
| InChIKey | ROAGSJUUMYHVLZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 38.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|
Analyze N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide?
The IUPAC name of N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide (CID 43822414) is N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide.
What is the SMILES notation for N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide?
The canonical SMILES for N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide is Cc1ccc(C)n1NC(=O)c1ccc(-n2c(C)ccc2C)cc1.
What is the InChIKey of N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide?
The InChIKey is ROAGSJUUMYHVLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O/c1-13-5-6-14(2)21(13)18-11-9-17(10-12-18)19(23)20-22-15(3)7-8-16(22)4/h5-12H,1-4H3,(H,20,23).
What are the key properties of N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide?
N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide has a molecular weight of 307.40 g/mol, XLogP of 3.90, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-bis(2,5-dimethylpyrrol-1-yl)benzamide is sourced from PubChem (CID 43822414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).