About 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide
3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide (PubChem CID 43823759) has the molecular formula C17H18FN3O
and a molecular weight of 299.35 g/mol. Its IUPAC name is 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide.
Molecular Properties
| Compound Name | 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide |
| PubChem CID | 43823759 |
| Molecular Formula | C17H18FN3O |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide |
| SMILES | NC(=O)c1ccc(F)c(CN2CCCc3cc(N)ccc32)c1 |
| InChI | InChI=1S/C17H18FN3O/c18-15-5-3-12(17(20)22)8-13(15)10-21-7-1-2-11-9-14(19)4-6-16(11)21/h3-6,8-9H,1-2,7,10,19H2,(H2,20,22) |
| InChIKey | PHAPCXIPMJZHHC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide?
The IUPAC name of 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide (CID 43823759) is 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide.
What is the SMILES notation for 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide?
The canonical SMILES for 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide is NC(=O)c1ccc(F)c(CN2CCCc3cc(N)ccc32)c1.
What is the InChIKey of 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide?
The InChIKey is PHAPCXIPMJZHHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O/c18-15-5-3-12(17(20)22)8-13(15)10-21-7-1-2-11-9-14(19)4-6-16(11)21/h3-6,8-9H,1-2,7,10,19H2,(H2,20,22).
What are the key properties of 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide?
3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide has a molecular weight of 299.35 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-amino-3,4-dihydro-2H-quinolin-1-yl)methyl]-4-fluorobenzamide is sourced from PubChem (CID 43823759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).