C19H23N3 — CID 43824534
3-[[3-[benzyl(methyl)amino]propylamino]methyl]benzonitrile (PubChem CID 43824534) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is 3-[[3-[benzyl(methyl)amino]propylamino]methyl]benzonitrile.
| Compound Name | 3-[[3-[benzyl(methyl)amino]propylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 43824534 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 3-[[3-[benzyl(methyl)amino]propylamino]methyl]benzonitrile |
| SMILES | CN(CCCNCc1cccc(C#N)c1)Cc1ccccc1 |
| InChI | InChI=1S/C19H23N3/c1-22(16-17-7-3-2-4-8-17)12-6-11-21-15-19-10-5-9-18(13-19)14-20/h2-5,7-10,13,21H,6,11-12,15-16H2,1H3 |
| InChIKey | SHNVSZJPJZPNNL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|