C13H15N3O3S — CID 43824852
N-(2-carbamothioylphenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)propanamide (PubChem CID 43824852) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is N-(2-carbamothioylphenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)propanamide.
| Compound Name | N-(2-carbamothioylphenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)propanamide |
|---|---|
| PubChem CID | 43824852 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | N-(2-carbamothioylphenyl)-2-(2-oxo-1,3-oxazolidin-3-yl)propanamide |
| SMILES | CC(C(=O)Nc1ccccc1C(N)=S)N1CCOC1=O |
| InChI | InChI=1S/C13H15N3O3S/c1-8(16-6-7-19-13(16)18)12(17)15-10-5-3-2-4-9(10)11(14)20/h2-5,8H,6-7H2,1H3,(H2,14,20)(H,15,17) |
| InChIKey | PIYWWJXNOPVSOQ-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|