About (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine
(3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine (PubChem CID 43825064) has the molecular formula C15H15ClN2O2
and a molecular weight of 290.75 g/mol. Its IUPAC name is (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine.
Molecular Properties
| Compound Name | (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine |
| PubChem CID | 43825064 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine |
| SMILES | Cc1cc([N+](=O)[O-])cc(C(N)c2cccc(Cl)c2)c1C |
| InChI | InChI=1S/C15H15ClN2O2/c1-9-6-13(18(19)20)8-14(10(9)2)15(17)11-4-3-5-12(16)7-11/h3-8,15H,17H2,1-2H3 |
| InChIKey | JXIDUQDXPWUVEQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine?
The IUPAC name of (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine (CID 43825064) is (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine.
What is the SMILES notation for (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine?
The canonical SMILES for (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine is Cc1cc([N+](=O)[O-])cc(C(N)c2cccc(Cl)c2)c1C.
What is the InChIKey of (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine?
The InChIKey is JXIDUQDXPWUVEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15ClN2O2/c1-9-6-13(18(19)20)8-14(10(9)2)15(17)11-4-3-5-12(16)7-11/h3-8,15H,17H2,1-2H3.
What are the key properties of (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine?
(3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine has a molecular weight of 290.75 g/mol, XLogP of 3.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-chlorophenyl)-(2,3-dimethyl-5-nitrophenyl)methanamine is sourced from PubChem (CID 43825064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).