About 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol
2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol (PubChem CID 43826665) has the molecular formula C18H19ClN2O
and a molecular weight of 314.82 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol.
Molecular Properties
| Compound Name | 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol |
| PubChem CID | 43826665 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol |
| SMILES | CC(C)c1ccc(O)c(C2CC(c3ccc(Cl)cc3)=NN2)c1 |
| InChI | InChI=1S/C18H19ClN2O/c1-11(2)13-5-8-18(22)15(9-13)17-10-16(20-21-17)12-3-6-14(19)7-4-12/h3-9,11,17,21-22H,10H2,1-2H3 |
| InChIKey | BCDPZSHJUCVCQX-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol?
The IUPAC name of 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol (CID 43826665) is 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol.
What is the SMILES notation for 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol?
The canonical SMILES for 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol is CC(C)c1ccc(O)c(C2CC(c3ccc(Cl)cc3)=NN2)c1.
What is the InChIKey of 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol?
The InChIKey is BCDPZSHJUCVCQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19ClN2O/c1-11(2)13-5-8-18(22)15(9-13)17-10-16(20-21-17)12-3-6-14(19)7-4-12/h3-9,11,17,21-22H,10H2,1-2H3.
What are the key properties of 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol?
2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol has a molecular weight of 314.82 g/mol, XLogP of 4.61, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-5-yl]-4-propan-2-ylphenol is sourced from PubChem (CID 43826665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).