C11H13N3O4S2 — CID 43827204
2-[1-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid (PubChem CID 43827204) has the molecular formula C11H13N3O4S2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 2-[1-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid.
| Compound Name | 2-[1-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 43827204 |
| Molecular Formula | C11H13N3O4S2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.03 |
| IUPAC Name | 2-[1-(5-ethyl-1,3,4-thiadiazol-2-yl)-2,5-dioxopyrrolidin-3-yl]sulfanylpropanoic acid |
| SMILES | CCc1nnc(N2C(=O)CC(SC(C)C(=O)O)C2=O)s1 |
| InChI | InChI=1S/C11H13N3O4S2/c1-3-7-12-13-11(20-7)14-8(15)4-6(9(14)16)19-5(2)10(17)18/h5-6H,3-4H2,1-2H3,(H,17,18) |
| InChIKey | OZRZWFAXEZFRMM-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 100.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|