About 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one
5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one (PubChem CID 43827529) has the molecular formula C5H4O3S3
and a molecular weight of 208.28 g/mol. Its IUPAC name is 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one.
Analyze 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one?
The IUPAC name of 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one (CID 43827529) is 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one.
What is the SMILES notation for 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one?
The canonical SMILES for 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one is O=c1sc2c(s1)CS(=O)(=O)C2.
What is the InChIKey of 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one?
The InChIKey is LJWOUSJUIGIGTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4O3S3/c6-5-9-3-1-11(7,8)2-4(3)10-5/h1-2H2.
What are the key properties of 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one?
5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one has a molecular weight of 208.28 g/mol, XLogP of 0.60, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dioxo-4,6-dihydrothieno[3,4-d][1,3]dithiol-2-one is sourced from PubChem (CID 43827529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).