C12H20ClNO4S2 — CID 43827664
O-(1-chloro-4-propoxybutan-2-yl) N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate (PubChem CID 43827664) has the molecular formula C12H20ClNO4S2 and a molecular weight of 341.88 g/mol. Its IUPAC name is O-(1-chloro-4-propoxybutan-2-yl) N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate.
| Compound Name | O-(1-chloro-4-propoxybutan-2-yl) N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate |
|---|---|
| PubChem CID | 43827664 |
| Molecular Formula | C12H20ClNO4S2 |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | O-(1-chloro-4-propoxybutan-2-yl) N-(1,1-dioxo-2,5-dihydrothiophen-3-yl)carbamothioate |
| SMILES | CCCOCCC(CCl)OC(=S)NC1=CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H20ClNO4S2/c1-2-5-17-6-3-11(8-13)18-12(19)14-10-4-7-20(15,16)9-10/h4,11H,2-3,5-9H2,1H3,(H,14,19) |
| InChIKey | IYUASLBYIGRACW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|