C9H16N2O3S — CID 43828062
1-butyl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)urea (PubChem CID 43828062) has the molecular formula C9H16N2O3S and a molecular weight of 232.30 g/mol. Its IUPAC name is 1-butyl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)urea.
| Compound Name | 1-butyl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)urea |
|---|---|
| PubChem CID | 43828062 |
| Molecular Formula | C9H16N2O3S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.09 |
| IUPAC Name | 1-butyl-3-(1,1-dioxo-2,3-dihydrothiophen-3-yl)urea |
| SMILES | CCCCNC(=O)NC1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C9H16N2O3S/c1-2-3-5-10-9(12)11-8-4-6-15(13,14)7-8/h4,6,8H,2-3,5,7H2,1H3,(H2,10,11,12) |
| InChIKey | DRCDELRVEBVPQT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|