About 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide
8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide (PubChem CID 43829186) has the molecular formula C10H13NO4
and a molecular weight of 211.22 g/mol. Its IUPAC name is 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide.
Molecular Properties
| Compound Name | 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide |
| PubChem CID | 43829186 |
| Molecular Formula | C10H13NO4 |
| Molecular Weight | 211.22 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide |
| SMILES | CC1(C)C2CCC1(C(N)=O)C(=O)OC2=O |
| InChI | InChI=1S/C10H13NO4/c1-9(2)5-3-4-10(9,7(11)13)8(14)15-6(5)12/h5H,3-4H2,1-2H3,(H2,11,13) |
| InChIKey | LDOJEYJKQSTIMH-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.22 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide?
The IUPAC name of 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide (CID 43829186) is 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide.
What is the SMILES notation for 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide?
The canonical SMILES for 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide is CC1(C)C2CCC1(C(N)=O)C(=O)OC2=O.
What is the InChIKey of 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide?
The InChIKey is LDOJEYJKQSTIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4/c1-9(2)5-3-4-10(9,7(11)13)8(14)15-6(5)12/h5H,3-4H2,1-2H3,(H2,11,13).
What are the key properties of 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide?
8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide has a molecular weight of 211.22 g/mol, XLogP of -0.02, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-2,4-dioxo-3-oxabicyclo[3.2.1]octane-1-carboxamide is sourced from PubChem (CID 43829186), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).