C10H15NO5 — CID 43829187
1-carbamoyl-2,2-dimethylcyclopentane-1,3-dicarboxylic acid (PubChem CID 43829187) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 1-carbamoyl-2,2-dimethylcyclopentane-1,3-dicarboxylic acid.
| Compound Name | 1-carbamoyl-2,2-dimethylcyclopentane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 43829187 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 1-carbamoyl-2,2-dimethylcyclopentane-1,3-dicarboxylic acid |
| SMILES | CC1(C)C(C(=O)O)CCC1(C(N)=O)C(=O)O |
| InChI | InChI=1S/C10H15NO5/c1-9(2)5(6(12)13)3-4-10(9,7(11)14)8(15)16/h5H,3-4H2,1-2H3,(H2,11,14)(H,12,13)(H,15,16) |
| InChIKey | YKPIWDZKHLODNT-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|