C20H32N2 — CID 43829671
5-(azepan-1-yl)-4-phenyloct-1-en-4-amine (PubChem CID 43829671) has the molecular formula C20H32N2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 5-(azepan-1-yl)-4-phenyloct-1-en-4-amine.
| Compound Name | 5-(azepan-1-yl)-4-phenyloct-1-en-4-amine |
|---|---|
| PubChem CID | 43829671 |
| Molecular Formula | C20H32N2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.26 |
| IUPAC Name | 5-(azepan-1-yl)-4-phenyloct-1-en-4-amine |
| SMILES | C=CCC(N)(c1ccccc1)C(CCC)N1CCCCCC1 |
| InChI | InChI=1S/C20H32N2/c1-3-12-19(22-16-10-5-6-11-17-22)20(21,15-4-2)18-13-8-7-9-14-18/h4,7-9,13-14,19H,2-3,5-6,10-12,15-17,21H2,1H3 |
| InChIKey | ILUCGZPXWFEEKZ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|