C17H27FN2 — CID 43830638
4-(2-fluorophenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine (PubChem CID 43830638) has the molecular formula C17H27FN2 and a molecular weight of 278.42 g/mol. Its IUPAC name is 4-(2-fluorophenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine.
| Compound Name | 4-(2-fluorophenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine |
|---|---|
| PubChem CID | 43830638 |
| Molecular Formula | C17H27FN2 |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 4-(2-fluorophenyl)-5-N,5-N-dimethylnon-1-ene-4,5-diamine |
| SMILES | C=CCC(N)(c1ccccc1F)C(CCCC)N(C)C |
| InChI | InChI=1S/C17H27FN2/c1-5-7-12-16(20(3)4)17(19,13-6-2)14-10-8-9-11-15(14)18/h6,8-11,16H,2,5,7,12-13,19H2,1,3-4H3 |
| InChIKey | RZIDEOPZAHQOET-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|