About 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine
3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine (PubChem CID 43830777) has the molecular formula C17H29ClN2
and a molecular weight of 296.89 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine |
| PubChem CID | 43830777 |
| Molecular Formula | C17H29ClN2 |
| Molecular Weight | 296.89 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine |
| SMILES | CCC(N(CC)CC)C(N)(c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C17H29ClN2/c1-6-16(20(7-2)8-3)17(19,13(4)5)14-9-11-15(18)12-10-14/h9-13,16H,6-8,19H2,1-5H3 |
| InChIKey | YTROTJBCEVXSLC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.89 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine?
The IUPAC name of 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine (CID 43830777) is 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine.
What is the SMILES notation for 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine?
The canonical SMILES for 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine is CCC(N(CC)CC)C(N)(c1ccc(Cl)cc1)C(C)C.
What is the InChIKey of 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine?
The InChIKey is YTROTJBCEVXSLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29ClN2/c1-6-16(20(7-2)8-3)17(19,13(4)5)14-9-11-15(18)12-10-14/h9-13,16H,6-8,19H2,1-5H3.
What are the key properties of 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine?
3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine has a molecular weight of 296.89 g/mol, XLogP of 4.27, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4-N,4-N-diethyl-2-methylhexane-3,4-diamine is sourced from PubChem (CID 43830777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).