About 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine
2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine (PubChem CID 43830805) has the molecular formula C17H21ClN2
and a molecular weight of 288.82 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine |
| PubChem CID | 43830805 |
| Molecular Formula | C17H21ClN2 |
| Molecular Weight | 288.82 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine |
| SMILES | CN(C)C(c1ccccc1)C(C)(N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClN2/c1-17(19,14-9-11-15(18)12-10-14)16(20(2)3)13-7-5-4-6-8-13/h4-12,16H,19H2,1-3H3 |
| InChIKey | CULUTWOGTYSUOK-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.82 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine?
The IUPAC name of 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine (CID 43830805) is 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine.
What is the SMILES notation for 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine?
The canonical SMILES for 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine is CN(C)C(c1ccccc1)C(C)(N)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine?
The InChIKey is CULUTWOGTYSUOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21ClN2/c1-17(19,14-9-11-15(18)12-10-14)16(20(2)3)13-7-5-4-6-8-13/h4-12,16H,19H2,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine?
2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine has a molecular weight of 288.82 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-N,1-N-dimethyl-1-phenylpropane-1,2-diamine is sourced from PubChem (CID 43830805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).