About 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine
2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine (PubChem CID 43830852) has the molecular formula C13H21ClN2
and a molecular weight of 240.78 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine |
| PubChem CID | 43830852 |
| Molecular Formula | C13H21ClN2 |
| Molecular Weight | 240.78 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine |
| SMILES | CCCC(N)(CN(C)C)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H21ClN2/c1-4-9-13(15,10-16(2)3)11-5-7-12(14)8-6-11/h5-8H,4,9-10,15H2,1-3H3 |
| InChIKey | OPXQHGHYKMWYRQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine?
The IUPAC name of 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine (CID 43830852) is 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine.
What is the SMILES notation for 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine?
The canonical SMILES for 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine is CCCC(N)(CN(C)C)c1ccc(Cl)cc1.
What is the InChIKey of 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine?
The InChIKey is OPXQHGHYKMWYRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21ClN2/c1-4-9-13(15,10-16(2)3)11-5-7-12(14)8-6-11/h5-8H,4,9-10,15H2,1-3H3.
What are the key properties of 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine?
2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine has a molecular weight of 240.78 g/mol, XLogP of 2.86, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-1-N,1-N-dimethylpentane-1,2-diamine is sourced from PubChem (CID 43830852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).