C16H24N2 — CID 43831011
2-N,2-N-diethyl-1-prop-2-enyl-2,3-dihydroindene-1,2-diamine (PubChem CID 43831011) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-prop-2-enyl-2,3-dihydroindene-1,2-diamine.
| Compound Name | 2-N,2-N-diethyl-1-prop-2-enyl-2,3-dihydroindene-1,2-diamine |
|---|---|
| PubChem CID | 43831011 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 2-N,2-N-diethyl-1-prop-2-enyl-2,3-dihydroindene-1,2-diamine |
| SMILES | C=CCC1(N)c2ccccc2CC1N(CC)CC |
| InChI | InChI=1S/C16H24N2/c1-4-11-16(17)14-10-8-7-9-13(14)12-15(16)18(5-2)6-3/h4,7-10,15H,1,5-6,11-12,17H2,2-3H3 |
| InChIKey | BCBVWNQDSLUXNE-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|