C13H14F2N2S — CID 43831040
4-(difluoromethyl)-2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[b]pyridine-3-carbonitrile (PubChem CID 43831040) has the molecular formula C13H14F2N2S and a molecular weight of 268.33 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[b]pyridine-3-carbonitrile.
| Compound Name | 4-(difluoromethyl)-2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[b]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 43831040 |
| Molecular Formula | C13H14F2N2S |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 4-(difluoromethyl)-2-sulfanylidene-5,6,7,8,9,10-hexahydro-1H-cycloocta[b]pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)F)c2c([nH]c1=S)CCCCCC2 |
| InChI | InChI=1S/C13H14F2N2S/c14-12(15)11-8-5-3-1-2-4-6-10(8)17-13(18)9(11)7-16/h12H,1-6H2,(H,17,18) |
| InChIKey | RPMJKYGMIULNDR-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_A(54)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|