C22H17NO4 — CID 43831578
3-(9H-fluoren-9-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (PubChem CID 43831578) has the molecular formula C22H17NO4 and a molecular weight of 359.38 g/mol. Its IUPAC name is 3-(9H-fluoren-9-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid.
| Compound Name | 3-(9H-fluoren-9-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 43831578 |
| Molecular Formula | C22H17NO4 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 3-(9H-fluoren-9-yl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| SMILES | O=C(O)C1C2C=CC3(CN(C4c5ccccc5-c5ccccc54)C(=O)C13)O2 |
| InChI | InChI=1S/C22H17NO4/c24-20-18-17(21(25)26)16-9-10-22(18,27-16)11-23(20)19-14-7-3-1-5-12(14)13-6-2-4-8-15(13)19/h1-10,16-19H,11H2,(H,25,26) |
| InChIKey | RUXUYUOWHGVBBN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|