C16H18N2O4 — CID 43831598
3-[1-(1-methylpyrrol-2-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid (PubChem CID 43831598) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is 3-[1-(1-methylpyrrol-2-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid.
| Compound Name | 3-[1-(1-methylpyrrol-2-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
|---|---|
| PubChem CID | 43831598 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 3-[1-(1-methylpyrrol-2-yl)ethyl]-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-6-carboxylic acid |
| SMILES | CC(c1cccn1C)N1CC23C=CC(O2)C(C(=O)O)C3C1=O |
| InChI | InChI=1S/C16H18N2O4/c1-9(10-4-3-7-17(10)2)18-8-16-6-5-11(22-16)12(15(20)21)13(16)14(18)19/h3-7,9,11-13H,8H2,1-2H3,(H,20,21) |
| InChIKey | IJPPAIRNLFFTLU-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|