About (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride
(2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride (PubChem CID 43833350) has the molecular formula C14H21Br2ClN2
and a molecular weight of 412.60 g/mol. Its IUPAC name is (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride.
Molecular Properties
| Compound Name | (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride |
| PubChem CID | 43833350 |
| Molecular Formula | C14H21Br2ClN2 |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 409.98 |
| IUPAC Name | (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride |
| SMILES | C[NH+](Cc1cc(Br)cc(Br)c1N)C1CCCCC1.[Cl-] |
| InChI | InChI=1S/C14H20Br2N2.ClH/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17;/h7-8,12H,2-6,9,17H2,1H3;1H |
| InChIKey | UCDKONUHZNTQPY-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 30.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride?
The IUPAC name of (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride (CID 43833350) is (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride.
What is the SMILES notation for (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride?
The canonical SMILES for (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride is C[NH+](Cc1cc(Br)cc(Br)c1N)C1CCCCC1.[Cl-].
What is the InChIKey of (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride?
The InChIKey is UCDKONUHZNTQPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20Br2N2.ClH/c1-18(12-5-3-2-4-6-12)9-10-7-11(15)8-13(16)14(10)17;/h7-8,12H,2-6,9,17H2,1H3;1H.
What are the key properties of (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride?
(2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride has a molecular weight of 412.60 g/mol, XLogP of 0.15, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-3,5-dibromophenyl)methyl-cyclohexyl-methylazanium chloride is sourced from PubChem (CID 43833350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).