C29H25ClO7 — CID 43833401
7,19-dimethoxy-13-phenyl-2-oxoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13,17(22),18,20-nonaene perchlorate (PubChem CID 43833401) has the molecular formula C29H25ClO7 and a molecular weight of 520.97 g/mol. Its IUPAC name is 7,19-dimethoxy-13-phenyl-2-oxoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13,17(22),18,20-nonaene perchlorate.
| Compound Name | 7,19-dimethoxy-13-phenyl-2-oxoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13,17(22),18,20-nonaene perchlorate |
|---|---|
| PubChem CID | 43833401 |
| Molecular Formula | C29H25ClO7 |
| Molecular Weight | 520.97 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | 7,19-dimethoxy-13-phenyl-2-oxoniapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4(9),5,7,13,17(22),18,20-nonaene perchlorate |
| SMILES | COc1ccc2c(c1)CCc1c-2[o+]c2c(c1-c1ccccc1)CCc1cc(OC)ccc1-2.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C29H25O3.ClHO4/c1-30-21-10-14-23-19(16-21)8-12-25-27(18-6-4-3-5-7-18)26-13-9-20-17-22(31-2)11-15-24(20)29(26)32-28(23)25;2-1(3,4)5/h3-7,10-11,14-17H,8-9,12-13H2,1-2H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | NMKIVRWPAWJCQH-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 122.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.97 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|