C18H32N4O2 — CID 43834019
N-[[3-[(pyrrolidine-1-carbonylamino)methyl]cyclohexyl]methyl]pyrrolidine-1-carboxamide (PubChem CID 43834019) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is N-[[3-[(pyrrolidine-1-carbonylamino)methyl]cyclohexyl]methyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[[3-[(pyrrolidine-1-carbonylamino)methyl]cyclohexyl]methyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 43834019 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | N-[[3-[(pyrrolidine-1-carbonylamino)methyl]cyclohexyl]methyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(NCC1CCCC(CNC(=O)N2CCCC2)C1)N1CCCC1 |
| InChI | InChI=1S/C18H32N4O2/c23-17(21-8-1-2-9-21)19-13-15-6-5-7-16(12-15)14-20-18(24)22-10-3-4-11-22/h15-16H,1-14H2,(H,19,23)(H,20,24) |
| InChIKey | CHEMOFBOSHKYEQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |