C17H23ClN6S — CID 43834071
3-[3-(4-methylpiperazin-4-ium-1-yl)propylsulfanyl]-5H-[1,2,4]triazino[5,6-b]indole chloride (PubChem CID 43834071) has the molecular formula C17H23ClN6S and a molecular weight of 378.93 g/mol. Its IUPAC name is 3-[3-(4-methylpiperazin-4-ium-1-yl)propylsulfanyl]-5H-[1,2,4]triazino[5,6-b]indole chloride.
| Compound Name | 3-[3-(4-methylpiperazin-4-ium-1-yl)propylsulfanyl]-5H-[1,2,4]triazino[5,6-b]indole chloride |
|---|---|
| PubChem CID | 43834071 |
| Molecular Formula | C17H23ClN6S |
| Molecular Weight | 378.93 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3-[3-(4-methylpiperazin-4-ium-1-yl)propylsulfanyl]-5H-[1,2,4]triazino[5,6-b]indole chloride |
| SMILES | C[NH+]1CCN(CCCSc2nnc3c(n2)[nH]c2ccccc23)CC1.[Cl-] |
| InChI | InChI=1S/C17H22N6S.ClH/c1-22-8-10-23(11-9-22)7-4-12-24-17-19-16-15(20-21-17)13-5-2-3-6-14(13)18-16;/h2-3,5-6H,4,7-12H2,1H3,(H,18,19,21);1H |
| InChIKey | JVXOBZHUWBVJOH-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 62.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.93 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|