About 4-phenyl-1,3-thiazol-3-ium-2-amine bromide
4-phenyl-1,3-thiazol-3-ium-2-amine bromide (PubChem CID 43834339) has the molecular formula C9H9BrN2S
and a molecular weight of 257.16 g/mol. Its IUPAC name is 4-phenyl-1,3-thiazol-3-ium-2-amine bromide.
Molecular Properties
| Compound Name | 4-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| PubChem CID | 43834339 |
| Molecular Formula | C9H9BrN2S |
| Molecular Weight | 257.16 g/mol |
| Exact Mass | 255.97 |
| IUPAC Name | 4-phenyl-1,3-thiazol-3-ium-2-amine bromide |
| SMILES | Nc1[nH+]c(-c2ccccc2)cs1.[Br-] |
| InChI | InChI=1S/C9H8N2S.BrH/c10-9-11-8(6-12-9)7-4-2-1-3-5-7;/h1-6H,(H2,10,11);1H |
| InChIKey | BRVIFECEZRXQTD-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 40.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.16 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-1,3-thiazol-3-ium-2-amine bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The IUPAC name of 4-phenyl-1,3-thiazol-3-ium-2-amine bromide (CID 43834339) is 4-phenyl-1,3-thiazol-3-ium-2-amine bromide.
What is the SMILES notation for 4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The canonical SMILES for 4-phenyl-1,3-thiazol-3-ium-2-amine bromide is Nc1[nH+]c(-c2ccccc2)cs1.[Br-].
What is the InChIKey of 4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
The InChIKey is BRVIFECEZRXQTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2S.BrH/c10-9-11-8(6-12-9)7-4-2-1-3-5-7;/h1-6H,(H2,10,11);1H.
What are the key properties of 4-phenyl-1,3-thiazol-3-ium-2-amine bromide?
4-phenyl-1,3-thiazol-3-ium-2-amine bromide has a molecular weight of 257.16 g/mol, XLogP of -1.18, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1,3-thiazol-3-ium-2-amine bromide is sourced from PubChem (CID 43834339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).