About [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride
[4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride (PubChem CID 43834453) has the molecular formula C5H8Cl2N4S
and a molecular weight of 227.12 g/mol. Its IUPAC name is [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride.
Molecular Properties
| Compound Name | [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride |
| PubChem CID | 43834453 |
| Molecular Formula | C5H8Cl2N4S |
| Molecular Weight | 227.12 g/mol |
| Exact Mass | 225.98 |
| IUPAC Name | [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride |
| SMILES | NC(N)=[NH+]c1nc(CCl)cs1.[Cl-] |
| InChI | InChI=1S/C5H7ClN4S.ClH/c6-1-3-2-11-5(9-3)10-4(7)8;/h2H,1H2,(H4,7,8,9,10);1H |
| InChIKey | HPXWWLGOFMSKHV-UHFFFAOYSA-N |
| XLogP | -4.13 |
| TPSA | 78.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.12 |
| LogP ≤ 5 | -4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride?
The IUPAC name of [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride (CID 43834453) is [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride.
What is the SMILES notation for [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride?
The canonical SMILES for [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride is NC(N)=[NH+]c1nc(CCl)cs1.[Cl-].
What is the InChIKey of [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride?
The InChIKey is HPXWWLGOFMSKHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClN4S.ClH/c6-1-3-2-11-5(9-3)10-4(7)8;/h2H,1H2,(H4,7,8,9,10);1H.
What are the key properties of [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride?
[4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride has a molecular weight of 227.12 g/mol, XLogP of -4.13, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(chloromethyl)-1,3-thiazol-2-yl]-(diaminomethylidene)azanium chloride is sourced from PubChem (CID 43834453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).