C28H17F4NO2 — CID 43835856
10-[bis(4-fluorophenyl)methylidene]-4-(2,6-difluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 43835856) has the molecular formula C28H17F4NO2 and a molecular weight of 475.44 g/mol. Its IUPAC name is 10-[bis(4-fluorophenyl)methylidene]-4-(2,6-difluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 10-[bis(4-fluorophenyl)methylidene]-4-(2,6-difluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 43835856 |
| Molecular Formula | C28H17F4NO2 |
| Molecular Weight | 475.44 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 10-[bis(4-fluorophenyl)methylidene]-4-(2,6-difluorophenyl)-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C3=C(c3ccc(F)cc3)c3ccc(F)cc3)C2C(=O)N1c1c(F)cccc1F |
| InChI | InChI=1S/C28H17F4NO2/c29-16-8-4-14(5-9-16)22(15-6-10-17(30)11-7-15)23-18-12-13-19(23)25-24(18)27(34)33(28(25)35)26-20(31)2-1-3-21(26)32/h1-13,18-19,24-25H |
| InChIKey | ZZYUIKPCFCGYGT-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.44 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|