C20H19N3O3S2 — CID 43837061
N-[4-methyl-5-[(4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 43837061) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[4-methyl-5-[(4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | N-[4-methyl-5-[(4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 43837061 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[4-methyl-5-[(4-nitrophenyl)methyl]-1,3-thiazol-2-yl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | Cc1nc(NC(=O)c2csc3c2CCCC3)sc1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-12-18(10-13-6-8-14(9-7-13)23(25)26)28-20(21-12)22-19(24)16-11-27-17-5-3-2-4-15(16)17/h6-9,11H,2-5,10H2,1H3,(H,21,22,24) |
| InChIKey | KFYWDWLGKUXGMX-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|