C19H23ClN2O3S2 — CID 43837611
N-[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide (PubChem CID 43837611) has the molecular formula C19H23ClN2O3S2 and a molecular weight of 426.99 g/mol. Its IUPAC name is N-[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide.
| Compound Name | N-[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
|---|---|
| PubChem CID | 43837611 |
| Molecular Formula | C19H23ClN2O3S2 |
| Molecular Weight | 426.99 g/mol |
| Exact Mass | 426.08 |
| IUPAC Name | N-[3-(3-chlorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-cyclopentylpropanamide |
| SMILES | O=C(CCC1CCCC1)/N=C1\SC2CS(=O)(=O)CC2N1c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H23ClN2O3S2/c20-14-6-3-7-15(10-14)22-16-11-27(24,25)12-17(16)26-19(22)21-18(23)9-8-13-4-1-2-5-13/h3,6-7,10,13,16-17H,1-2,4-5,8-9,11-12H2/b21-19- |
| InChIKey | DPCALUONFOQXND-VZCXRCSSSA-N |
| XLogP | 3.91 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.99 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|