C20H18Cl2N2O3S2 — CID 43837801
2-(2-chlorophenyl)-N-[3-[(4-chlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide (PubChem CID 43837801) has the molecular formula C20H18Cl2N2O3S2 and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[3-[(4-chlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[3-[(4-chlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
|---|---|
| PubChem CID | 43837801 |
| Molecular Formula | C20H18Cl2N2O3S2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 468.01 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[3-[(4-chlorophenyl)methyl]-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]acetamide |
| SMILES | O=C(Cc1ccccc1Cl)/N=C1\SC2CS(=O)(=O)CC2N1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H18Cl2N2O3S2/c21-15-7-5-13(6-8-15)10-24-17-11-29(26,27)12-18(17)28-20(24)23-19(25)9-14-3-1-2-4-16(14)22/h1-8,17-18H,9-12H2/b23-20- |
| InChIKey | LOSQGGCIOYPDPB-ATJXCDBQSA-N |
| XLogP | 3.83 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|