C19H15Cl2FN2O3S2 — CID 43838614
N-[3-(3-chloro-4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide (PubChem CID 43838614) has the molecular formula C19H15Cl2FN2O3S2 and a molecular weight of 473.38 g/mol. Its IUPAC name is N-[3-(3-chloro-4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide.
| Compound Name | N-[3-(3-chloro-4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 43838614 |
| Molecular Formula | C19H15Cl2FN2O3S2 |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 471.99 |
| IUPAC Name | N-[3-(3-chloro-4-fluorophenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(4-chlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)cc1)/N=C1\SC2CS(=O)(=O)CC2N1c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H15Cl2FN2O3S2/c20-12-3-1-11(2-4-12)7-18(25)23-19-24(13-5-6-15(22)14(21)8-13)16-9-29(26,27)10-17(16)28-19/h1-6,8,16-17H,7,9-10H2/b23-19- |
| InChIKey | GLMWWCSWPCCPPF-NMWGTECJSA-N |
| XLogP | 3.98 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|