C22H22N2O5S2 — CID 43838890
N-[3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide (PubChem CID 43838890) has the molecular formula C22H22N2O5S2 and a molecular weight of 458.56 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43838890 |
| Molecular Formula | C22H22N2O5S2 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylmethyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)/N=C1\SC2CS(=O)(=O)CC2N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C22H22N2O5S2/c25-21(9-7-15-4-2-1-3-5-15)23-22-24(17-12-31(26,27)13-20(17)30-22)11-16-6-8-18-19(10-16)29-14-28-18/h1-6,8,10,17,20H,7,9,11-14H2/b23-22- |
| InChIKey | VTVMPCPJTLEFKP-FCQUAONHSA-N |
| XLogP | 2.65 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|