C24H28N2O3S2 — CID 43838979
N-[3-(2,6-diethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide (PubChem CID 43838979) has the molecular formula C24H28N2O3S2 and a molecular weight of 456.63 g/mol. Its IUPAC name is N-[3-(2,6-diethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide.
| Compound Name | N-[3-(2,6-diethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide |
|---|---|
| PubChem CID | 43838979 |
| Molecular Formula | C24H28N2O3S2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-[3-(2,6-diethylphenyl)-5,5-dioxo-3a,4,6,6a-tetrahydrothieno[3,4-d][1,3]thiazol-2-ylidene]-2-(3-methylphenyl)acetamide |
| SMILES | CCc1cccc(CC)c1N1/C(=N/C(=O)Cc2cccc(C)c2)SC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C24H28N2O3S2/c1-4-18-10-7-11-19(5-2)23(18)26-20-14-31(28,29)15-21(20)30-24(26)25-22(27)13-17-9-6-8-16(3)12-17/h6-12,20-21H,4-5,13-15H2,1-3H3/b25-24- |
| InChIKey | UOQAXIUUPKGHMZ-IZHYLOQSSA-N |
| XLogP | 3.96 |
| TPSA | 66.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|